About di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate
di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate (PubChem CID 121004008) has the molecular formula C13H30N2O2
and a molecular weight of 246.39 g/mol. Its IUPAC name is di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate.
Molecular Properties
| Compound Name | di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate |
| PubChem CID | 121004008 |
| Molecular Formula | C13H30N2O2 |
| Molecular Weight | 246.39 g/mol |
| Exact Mass | 246.23 |
| IUPAC Name | di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate |
| SMILES | CC(C)N(C(=O)[O-])C(C)C.CC(C)[NH2+]C(C)C |
| InChI | InChI=1S/C7H15NO2.C6H15N/c1-5(2)8(6(3)4)7(9)10;1-5(2)7-6(3)4/h5-6H,1-4H3,(H,9,10);5-7H,1-4H3 |
| InChIKey | KVUZHKQTVNFWCG-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 59.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.39 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate?
The IUPAC name of di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate (CID 121004008) is di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate.
What is the SMILES notation for di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate?
The canonical SMILES for di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate is CC(C)N(C(=O)[O-])C(C)C.CC(C)[NH2+]C(C)C.
What is the InChIKey of di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate?
The InChIKey is KVUZHKQTVNFWCG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO2.C6H15N/c1-5(2)8(6(3)4)7(9)10;1-5(2)7-6(3)4/h5-6H,1-4H3,(H,9,10);5-7H,1-4H3.
What are the key properties of di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate?
di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate has a molecular weight of 246.39 g/mol, XLogP of 0.82, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for di(propan-2-yl)azanium;N,N-di(propan-2-yl)carbamate is sourced from PubChem (CID 121004008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).