About (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine
(Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine (PubChem CID 121006465) has the molecular formula C11H23NS2
and a molecular weight of 233.45 g/mol. Its IUPAC name is (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine.
Molecular Properties
| Compound Name | (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine |
| PubChem CID | 121006465 |
| Molecular Formula | C11H23NS2 |
| Molecular Weight | 233.45 g/mol |
| Exact Mass | 233.13 |
| IUPAC Name | (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine |
| SMILES | CC(C)S/C=C(/CN(C)C)SC(C)C |
| InChI | InChI=1S/C11H23NS2/c1-9(2)13-8-11(7-12(5)6)14-10(3)4/h8-10H,7H2,1-6H3/b11-8- |
| InChIKey | ABQTVKQEIGOGHX-FLIBITNWSA-N |
| XLogP | 3.67 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 233.45 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine?
The IUPAC name of (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine (CID 121006465) is (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine.
What is the SMILES notation for (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine?
The canonical SMILES for (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine is CC(C)S/C=C(/CN(C)C)SC(C)C.
What is the InChIKey of (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine?
The InChIKey is ABQTVKQEIGOGHX-FLIBITNWSA-N. The full InChI is InChI=1S/C11H23NS2/c1-9(2)13-8-11(7-12(5)6)14-10(3)4/h8-10H,7H2,1-6H3/b11-8-.
What are the key properties of (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine?
(Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine has a molecular weight of 233.45 g/mol, XLogP of 3.67, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-N,N-dimethyl-2,3-bis(propan-2-ylsulfanyl)prop-2-en-1-amine is sourced from PubChem (CID 121006465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).