methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate

C11H11BrO4 — CID 121006519

IUPACmethyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate
SMILESCOC(=O)c1ccc(C(Br)C(=O)OC)cc1
InChIInChI=1S/C11H11BrO4/c1-15-10(13)8-5-3-7(4-6-8)9(12)11(14)16-2/h3-6,9H,1-2H3
InChIKeyOMRUMXJWIOUVMY-UHFFFAOYSA-N
MW287.11 g/mol
LogP2.08
Rot. Bonds3

About methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate

methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate (PubChem CID 121006519) has the molecular formula C11H11BrO4 and a molecular weight of 287.11 g/mol. Its IUPAC name is methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate.

Molecular Properties

Compound Namemethyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate
PubChem CID121006519
Molecular FormulaC11H11BrO4
Molecular Weight287.11 g/mol
Exact Mass285.98
IUPAC Namemethyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate
SMILESCOC(=O)c1ccc(C(Br)C(=O)OC)cc1
InChIInChI=1S/C11H11BrO4/c1-15-10(13)8-5-3-7(4-6-8)9(12)11(14)16-2/h3-6,9H,1-2H3
InChIKeyOMRUMXJWIOUVMY-UHFFFAOYSA-N
XLogP2.08
TPSA52.60 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500287.11
LogP ≤ 52.08
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate?
The IUPAC name of methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate (CID 121006519) is methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate.
What is the SMILES notation for methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate?
The canonical SMILES for methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate is COC(=O)c1ccc(C(Br)C(=O)OC)cc1.
What is the InChIKey of methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate?
The InChIKey is OMRUMXJWIOUVMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11BrO4/c1-15-10(13)8-5-3-7(4-6-8)9(12)11(14)16-2/h3-6,9H,1-2H3.
What are the key properties of methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate?
methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate has a molecular weight of 287.11 g/mol, XLogP of 2.08, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(1-bromo-2-methoxy-2-oxoethyl)benzoate is sourced from PubChem (CID 121006519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).