About 1,6-diethoxy-2,5-dimethylhexane
1,6-diethoxy-2,5-dimethylhexane (PubChem CID 121007544) has the molecular formula C12H26O2
and a molecular weight of 202.34 g/mol. Its IUPAC name is 1,6-diethoxy-2,5-dimethylhexane.
Molecular Properties
| Compound Name | 1,6-diethoxy-2,5-dimethylhexane |
| PubChem CID | 121007544 |
| Molecular Formula | C12H26O2 |
| Molecular Weight | 202.34 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | 1,6-diethoxy-2,5-dimethylhexane |
| SMILES | CCOCC(C)CCC(C)COCC |
| InChI | InChI=1S/C12H26O2/c1-5-13-9-11(3)7-8-12(4)10-14-6-2/h11-12H,5-10H2,1-4H3 |
| InChIKey | IRUSOIXTDJYKPP-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.34 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1,6-diethoxy-2,5-dimethylhexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,6-diethoxy-2,5-dimethylhexane?
The IUPAC name of 1,6-diethoxy-2,5-dimethylhexane (CID 121007544) is 1,6-diethoxy-2,5-dimethylhexane.
What is the SMILES notation for 1,6-diethoxy-2,5-dimethylhexane?
The canonical SMILES for 1,6-diethoxy-2,5-dimethylhexane is CCOCC(C)CCC(C)COCC.
What is the InChIKey of 1,6-diethoxy-2,5-dimethylhexane?
The InChIKey is IRUSOIXTDJYKPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26O2/c1-5-13-9-11(3)7-8-12(4)10-14-6-2/h11-12H,5-10H2,1-4H3.
What are the key properties of 1,6-diethoxy-2,5-dimethylhexane?
1,6-diethoxy-2,5-dimethylhexane has a molecular weight of 202.34 g/mol, XLogP of 3.11, 9 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,6-diethoxy-2,5-dimethylhexane is sourced from PubChem (CID 121007544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).