C12H20N2S2 — CID 121007849
2,5-bis(tert-butylsulfanyl)pyrazine (PubChem CID 121007849) has the molecular formula C12H20N2S2 and a molecular weight of 256.44 g/mol. Its IUPAC name is 2,5-bis(tert-butylsulfanyl)pyrazine.
| Compound Name | 2,5-bis(tert-butylsulfanyl)pyrazine |
|---|---|
| PubChem CID | 121007849 |
| Molecular Formula | C12H20N2S2 |
| Molecular Weight | 256.44 g/mol |
| Exact Mass | 256.11 |
| IUPAC Name | 2,5-bis(tert-butylsulfanyl)pyrazine |
| SMILES | CC(C)(C)Sc1cnc(SC(C)(C)C)cn1 |
| InChI | InChI=1S/C12H20N2S2/c1-11(2,3)15-9-7-14-10(8-13-9)16-12(4,5)6/h7-8H,1-6H3 |
| InChIKey | LOJXKAANLWOILN-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.44 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |