C12H17F9O — CID 121008108
(2S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)octan-1-ol (PubChem CID 121008108) has the molecular formula C12H17F9O and a molecular weight of 348.25 g/mol. Its IUPAC name is (2S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)octan-1-ol.
| Compound Name | (2S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)octan-1-ol |
|---|---|
| PubChem CID | 121008108 |
| Molecular Formula | C12H17F9O |
| Molecular Weight | 348.25 g/mol |
| Exact Mass | 348.11 |
| IUPAC Name | (2S)-2-(1,1,2,2,3,3,4,4,4-nonafluorobutyl)octan-1-ol |
| SMILES | CCCCCC[C@@H](CO)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C12H17F9O/c1-2-3-4-5-6-8(7-22)9(13,14)10(15,16)11(17,18)12(19,20)21/h8,22H,2-7H2,1H3/t8-/m0/s1 |
| InChIKey | YZHBNWFCJSAYBH-QMMMGPOBSA-N |
| XLogP | 5.03 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.25 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|