About 7-propan-2-yl-1H-furo[2,3-g]indazole
7-propan-2-yl-1H-furo[2,3-g]indazole (PubChem CID 121008490) has the molecular formula C12H12N2O
and a molecular weight of 200.24 g/mol. Its IUPAC name is 7-propan-2-yl-1H-furo[2,3-g]indazole.
Molecular Properties
| Compound Name | 7-propan-2-yl-1H-furo[2,3-g]indazole |
| PubChem CID | 121008490 |
| Molecular Formula | C12H12N2O |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.09 |
| IUPAC Name | 7-propan-2-yl-1H-furo[2,3-g]indazole |
| SMILES | CC(C)c1cc2c(ccc3cn[nH]c32)o1 |
| InChI | InChI=1S/C12H12N2O/c1-7(2)11-5-9-10(15-11)4-3-8-6-13-14-12(8)9/h3-7H,1-2H3,(H,13,14) |
| InChIKey | SPZMLXXFIKQKKF-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-propan-2-yl-1H-furo[2,3-g]indazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-propan-2-yl-1H-furo[2,3-g]indazole?
The IUPAC name of 7-propan-2-yl-1H-furo[2,3-g]indazole (CID 121008490) is 7-propan-2-yl-1H-furo[2,3-g]indazole.
What is the SMILES notation for 7-propan-2-yl-1H-furo[2,3-g]indazole?
The canonical SMILES for 7-propan-2-yl-1H-furo[2,3-g]indazole is CC(C)c1cc2c(ccc3cn[nH]c32)o1.
What is the InChIKey of 7-propan-2-yl-1H-furo[2,3-g]indazole?
The InChIKey is SPZMLXXFIKQKKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O/c1-7(2)11-5-9-10(15-11)4-3-8-6-13-14-12(8)9/h3-7H,1-2H3,(H,13,14).
What are the key properties of 7-propan-2-yl-1H-furo[2,3-g]indazole?
7-propan-2-yl-1H-furo[2,3-g]indazole has a molecular weight of 200.24 g/mol, XLogP of 3.43, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-propan-2-yl-1H-furo[2,3-g]indazole is sourced from PubChem (CID 121008490), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).