About 5-tert-butyl-2,7-dinitro-1-benzofuran
5-tert-butyl-2,7-dinitro-1-benzofuran (PubChem CID 121008664) has the molecular formula C12H12N2O5
and a molecular weight of 264.24 g/mol. Its IUPAC name is 5-tert-butyl-2,7-dinitro-1-benzofuran.
Molecular Properties
| Compound Name | 5-tert-butyl-2,7-dinitro-1-benzofuran |
| PubChem CID | 121008664 |
| Molecular Formula | C12H12N2O5 |
| Molecular Weight | 264.24 g/mol |
| Exact Mass | 264.07 |
| IUPAC Name | 5-tert-butyl-2,7-dinitro-1-benzofuran |
| SMILES | CC(C)(C)c1cc([N+](=O)[O-])c2oc([N+](=O)[O-])cc2c1 |
| InChI | InChI=1S/C12H12N2O5/c1-12(2,3)8-4-7-5-10(14(17)18)19-11(7)9(6-8)13(15)16/h4-6H,1-3H3 |
| InChIKey | NUKVGJBQIBAHRN-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 99.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.24 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-tert-butyl-2,7-dinitro-1-benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-tert-butyl-2,7-dinitro-1-benzofuran?
The IUPAC name of 5-tert-butyl-2,7-dinitro-1-benzofuran (CID 121008664) is 5-tert-butyl-2,7-dinitro-1-benzofuran.
What is the SMILES notation for 5-tert-butyl-2,7-dinitro-1-benzofuran?
The canonical SMILES for 5-tert-butyl-2,7-dinitro-1-benzofuran is CC(C)(C)c1cc([N+](=O)[O-])c2oc([N+](=O)[O-])cc2c1.
What is the InChIKey of 5-tert-butyl-2,7-dinitro-1-benzofuran?
The InChIKey is NUKVGJBQIBAHRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N2O5/c1-12(2,3)8-4-7-5-10(14(17)18)19-11(7)9(6-8)13(15)16/h4-6H,1-3H3.
What are the key properties of 5-tert-butyl-2,7-dinitro-1-benzofuran?
5-tert-butyl-2,7-dinitro-1-benzofuran has a molecular weight of 264.24 g/mol, XLogP of 3.55, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-tert-butyl-2,7-dinitro-1-benzofuran is sourced from PubChem (CID 121008664), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).