C12H18O — CID 121008731
(5E)-3-ethenyl-4-prop-2-enylhepta-1,5-dien-3-ol (PubChem CID 121008731) has the molecular formula C12H18O and a molecular weight of 178.27 g/mol. Its IUPAC name is (5E)-3-ethenyl-4-prop-2-enylhepta-1,5-dien-3-ol.
| Compound Name | (5E)-3-ethenyl-4-prop-2-enylhepta-1,5-dien-3-ol |
|---|---|
| PubChem CID | 121008731 |
| Molecular Formula | C12H18O |
| Molecular Weight | 178.27 g/mol |
| Exact Mass | 178.14 |
| IUPAC Name | (5E)-3-ethenyl-4-prop-2-enylhepta-1,5-dien-3-ol |
| SMILES | C=CCC(/C=C/C)C(O)(C=C)C=C |
| InChI | InChI=1S/C12H18O/c1-5-9-11(10-6-2)12(13,7-3)8-4/h5-8,10-11,13H,1,3-4,9H2,2H3/b10-6+ |
| InChIKey | SNVIJVIQEMULLO-UXBLZVDNSA-N |
| XLogP | 2.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|