C12H9NO2 — CID 121008796
(NE)-N-(2-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-4-ylidene)hydroxylamine (PubChem CID 121008796) has the molecular formula C12H9NO2 and a molecular weight of 199.21 g/mol. Its IUPAC name is (NE)-N-(2-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-4-ylidene)hydroxylamine.
| Compound Name | (NE)-N-(2-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-4-ylidene)hydroxylamine |
|---|---|
| PubChem CID | 121008796 |
| Molecular Formula | C12H9NO2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.06 |
| IUPAC Name | (NE)-N-(2-oxatricyclo[7.3.1.05,13]trideca-1(12),5,7,9(13),10-pentaen-4-ylidene)hydroxylamine |
| SMILES | O/N=C1/COc2cccc3cccc1c23 |
| InChI | InChI=1S/C12H9NO2/c14-13-10-7-15-11-6-2-4-8-3-1-5-9(10)12(8)11/h1-6,14H,7H2/b13-10- |
| InChIKey | BNEJWIQGAOLNQD-RAXLEYEMSA-N |
| XLogP | 2.41 |
| TPSA | 41.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|