C12H14O2 — CID 121009792
(2E,8E)-2,9-dimethoxydeca-2,8-dien-4,6-diyne (PubChem CID 121009792) has the molecular formula C12H14O2 and a molecular weight of 190.24 g/mol. Its IUPAC name is (2E,8E)-2,9-dimethoxydeca-2,8-dien-4,6-diyne.
| Compound Name | (2E,8E)-2,9-dimethoxydeca-2,8-dien-4,6-diyne |
|---|---|
| PubChem CID | 121009792 |
| Molecular Formula | C12H14O2 |
| Molecular Weight | 190.24 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | (2E,8E)-2,9-dimethoxydeca-2,8-dien-4,6-diyne |
| SMILES | CO/C(C)=C/C#CC#C/C=C(\C)OC |
| InChI | InChI=1S/C12H14O2/c1-11(13-3)9-7-5-6-8-10-12(2)14-4/h9-10H,1-4H3/b11-9+,12-10+ |
| InChIKey | QTOHRIQLEOIGTI-WGDLNXRISA-N |
| XLogP | 2.09 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.24 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|