About 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene
12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene (PubChem CID 121011024) has the molecular formula C12H22N2
and a molecular weight of 194.32 g/mol. Its IUPAC name is 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene.
Molecular Properties
| Compound Name | 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene |
| PubChem CID | 121011024 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene |
| SMILES | C1CCCCC2=NNC(CCCC1)C2 |
| InChI | InChI=1S/C12H22N2/c1-2-4-6-8-11-10-12(14-13-11)9-7-5-3-1/h11,13H,1-10H2 |
| InChIKey | LLGHAXONHABOTE-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene?
The IUPAC name of 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene (CID 121011024) is 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene.
What is the SMILES notation for 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene?
The canonical SMILES for 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene is C1CCCCC2=NNC(CCCC1)C2.
What is the InChIKey of 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene?
The InChIKey is LLGHAXONHABOTE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2/c1-2-4-6-8-11-10-12(14-13-11)9-7-5-3-1/h11,13H,1-10H2.
What are the key properties of 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene?
12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene has a molecular weight of 194.32 g/mol, XLogP of 3.23, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 12,13-diazabicyclo[9.2.1]tetradec-1(13)-ene is sourced from PubChem (CID 121011024), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).