C12H15NO — CID 121011436
1,2,3,4,5,6-hexahydro-1-benzazonin-7-one (PubChem CID 121011436) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 1,2,3,4,5,6-hexahydro-1-benzazonin-7-one.
| Compound Name | 1,2,3,4,5,6-hexahydro-1-benzazonin-7-one |
|---|---|
| PubChem CID | 121011436 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 1,2,3,4,5,6-hexahydro-1-benzazonin-7-one |
| SMILES | O=C1CCCCCNc2ccccc21 |
| InChI | InChI=1S/C12H15NO/c14-12-8-2-1-5-9-13-11-7-4-3-6-10(11)12/h3-4,6-7,13H,1-2,5,8-9H2 |
| InChIKey | IOYJRNHHUZXTEH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |