About 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one
4-(indol-1-ylmethyl)-1,3-dioxolan-2-one (PubChem CID 121011576) has the molecular formula C12H11NO3
and a molecular weight of 217.22 g/mol. Its IUPAC name is 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one.
Molecular Properties
| Compound Name | 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one |
| PubChem CID | 121011576 |
| Molecular Formula | C12H11NO3 |
| Molecular Weight | 217.22 g/mol |
| Exact Mass | 217.07 |
| IUPAC Name | 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one |
| SMILES | O=C1OCC(Cn2ccc3ccccc32)O1 |
| InChI | InChI=1S/C12H11NO3/c14-12-15-8-10(16-12)7-13-6-5-9-3-1-2-4-11(9)13/h1-6,10H,7-8H2 |
| InChIKey | RTERLCQAHHLEKK-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one?
The IUPAC name of 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one (CID 121011576) is 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one.
What is the SMILES notation for 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one?
The canonical SMILES for 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one is O=C1OCC(Cn2ccc3ccccc32)O1.
What is the InChIKey of 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one?
The InChIKey is RTERLCQAHHLEKK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11NO3/c14-12-15-8-10(16-12)7-13-6-5-9-3-1-2-4-11(9)13/h1-6,10H,7-8H2.
What are the key properties of 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one?
4-(indol-1-ylmethyl)-1,3-dioxolan-2-one has a molecular weight of 217.22 g/mol, XLogP of 2.18, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(indol-1-ylmethyl)-1,3-dioxolan-2-one is sourced from PubChem (CID 121011576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).