C12H24O2 — CID 121011929
(2R,3R,5S)-5-hexyl-2,3-dimethyl-1,4-dioxane (PubChem CID 121011929) has the molecular formula C12H24O2 and a molecular weight of 200.32 g/mol. Its IUPAC name is (2R,3R,5S)-5-hexyl-2,3-dimethyl-1,4-dioxane.
| Compound Name | (2R,3R,5S)-5-hexyl-2,3-dimethyl-1,4-dioxane |
|---|---|
| PubChem CID | 121011929 |
| Molecular Formula | C12H24O2 |
| Molecular Weight | 200.32 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | (2R,3R,5S)-5-hexyl-2,3-dimethyl-1,4-dioxane |
| SMILES | CCCCCC[C@H]1CO[C@H](C)[C@@H](C)O1 |
| InChI | InChI=1S/C12H24O2/c1-4-5-6-7-8-12-9-13-10(2)11(3)14-12/h10-12H,4-9H2,1-3H3/t10-,11-,12+/m1/s1 |
| InChIKey | MINIMUZAYBFQJL-UTUOFQBUSA-N |
| XLogP | 3.15 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.32 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|