About 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline
4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline (PubChem CID 121012267) has the molecular formula C12H15Cl3N2O2
and a molecular weight of 325.62 g/mol. Its IUPAC name is 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline.
Molecular Properties
| Compound Name | 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline |
| PubChem CID | 121012267 |
| Molecular Formula | C12H15Cl3N2O2 |
| Molecular Weight | 325.62 g/mol |
| Exact Mass | 324.02 |
| IUPAC Name | 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline |
| SMILES | CCC(C(Nc1ccc(C)cc1)C(Cl)(Cl)Cl)[N+](=O)[O-] |
| InChI | InChI=1S/C12H15Cl3N2O2/c1-3-10(17(18)19)11(12(13,14)15)16-9-6-4-8(2)5-7-9/h4-7,10-11,16H,3H2,1-2H3 |
| InChIKey | IUANCRGLXHTXGH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 325.62 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline?
The IUPAC name of 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline (CID 121012267) is 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline.
What is the SMILES notation for 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline?
The canonical SMILES for 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline is CCC(C(Nc1ccc(C)cc1)C(Cl)(Cl)Cl)[N+](=O)[O-].
What is the InChIKey of 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline?
The InChIKey is IUANCRGLXHTXGH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15Cl3N2O2/c1-3-10(17(18)19)11(12(13,14)15)16-9-6-4-8(2)5-7-9/h4-7,10-11,16H,3H2,1-2H3.
What are the key properties of 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline?
4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline has a molecular weight of 325.62 g/mol, XLogP of 4.20, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methyl-N-(1,1,1-trichloro-3-nitropentan-2-yl)aniline is sourced from PubChem (CID 121012267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).