C12H20O2 — CID 121012351
(2E,4E,6S)-4,6-dimethyldeca-2,4-dienoic acid (PubChem CID 121012351) has the molecular formula C12H20O2 and a molecular weight of 196.29 g/mol. Its IUPAC name is (2E,4E,6S)-4,6-dimethyldeca-2,4-dienoic acid.
| Compound Name | (2E,4E,6S)-4,6-dimethyldeca-2,4-dienoic acid |
|---|---|
| PubChem CID | 121012351 |
| Molecular Formula | C12H20O2 |
| Molecular Weight | 196.29 g/mol |
| Exact Mass | 196.15 |
| IUPAC Name | (2E,4E,6S)-4,6-dimethyldeca-2,4-dienoic acid |
| SMILES | CCCC[C@H](C)/C=C(C)/C=C/C(=O)O |
| InChI | InChI=1S/C12H20O2/c1-4-5-6-10(2)9-11(3)7-8-12(13)14/h7-10H,4-6H2,1-3H3,(H,13,14)/b8-7+,11-9+/t10-/m0/s1 |
| InChIKey | DZXNZBWYVLLUAX-IVONAZQTSA-N |
| XLogP | 3.40 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.29 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|