C12H22N2O4 — CID 121012640
1,4-dioxa-7,14-diazacyclohexadecane-8,13-dione (PubChem CID 121012640) has the molecular formula C12H22N2O4 and a molecular weight of 258.32 g/mol. Its IUPAC name is 1,4-dioxa-7,14-diazacyclohexadecane-8,13-dione.
| Compound Name | 1,4-dioxa-7,14-diazacyclohexadecane-8,13-dione |
|---|---|
| PubChem CID | 121012640 |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.16 |
| IUPAC Name | 1,4-dioxa-7,14-diazacyclohexadecane-8,13-dione |
| SMILES | O=C1CCCCC(=O)NCCOCCOCCN1 |
| InChI | InChI=1S/C12H22N2O4/c15-11-3-1-2-4-12(16)14-6-8-18-10-9-17-7-5-13-11/h1-10H2,(H,13,15)(H,14,16) |
| InChIKey | MLZTVTMWNSCAFR-UHFFFAOYSA-N |
| XLogP | -0.17 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |