(3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate

C12H9Cl2NO3 — CID 121013645

IUPAC(3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate
SMILESCC(=O)OCc1c(Cl)c(=O)[nH]c2ccc(Cl)cc12
InChIInChI=1S/C12H9Cl2NO3/c1-6(16)18-5-9-8-4-7(13)2-3-10(8)15-12(17)11(9)14/h2-4H,5H2,1H3,(H,15,17)
InChIKeyRCJPPUOLYFNLQD-UHFFFAOYSA-N
MW286.11 g/mol
LogP2.90
Rot. Bonds2

About (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate

(3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate (PubChem CID 121013645) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate.

Molecular Properties

Compound Name(3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate
PubChem CID121013645
Molecular FormulaC12H9Cl2NO3
Molecular Weight286.11 g/mol
Exact Mass285.00
IUPAC Name(3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate
SMILESCC(=O)OCc1c(Cl)c(=O)[nH]c2ccc(Cl)cc12
InChIInChI=1S/C12H9Cl2NO3/c1-6(16)18-5-9-8-4-7(13)2-3-10(8)15-12(17)11(9)14/h2-4H,5H2,1H3,(H,15,17)
InChIKeyRCJPPUOLYFNLQD-UHFFFAOYSA-N
XLogP2.90
TPSA59.16 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.11
LogP ≤ 52.90
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate?
The IUPAC name of (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate (CID 121013645) is (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate.
What is the SMILES notation for (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate?
The canonical SMILES for (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate is CC(=O)OCc1c(Cl)c(=O)[nH]c2ccc(Cl)cc12.
What is the InChIKey of (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate?
The InChIKey is RCJPPUOLYFNLQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9Cl2NO3/c1-6(16)18-5-9-8-4-7(13)2-3-10(8)15-12(17)11(9)14/h2-4H,5H2,1H3,(H,15,17).
What are the key properties of (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate?
(3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate has a molecular weight of 286.11 g/mol, XLogP of 2.90, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate is sourced from PubChem (CID 121013645), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).