C12H9Cl2NO3 — CID 121013645
(3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate (PubChem CID 121013645) has the molecular formula C12H9Cl2NO3 and a molecular weight of 286.11 g/mol. Its IUPAC name is (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate.
| Compound Name | (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate |
|---|---|
| PubChem CID | 121013645 |
| Molecular Formula | C12H9Cl2NO3 |
| Molecular Weight | 286.11 g/mol |
| Exact Mass | 285.00 |
| IUPAC Name | (3,6-dichloro-2-oxo-1H-quinolin-4-yl)methyl acetate |
| SMILES | CC(=O)OCc1c(Cl)c(=O)[nH]c2ccc(Cl)cc12 |
| InChI | InChI=1S/C12H9Cl2NO3/c1-6(16)18-5-9-8-4-7(13)2-3-10(8)15-12(17)11(9)14/h2-4H,5H2,1H3,(H,15,17) |
| InChIKey | RCJPPUOLYFNLQD-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 59.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.11 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |