About 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine
3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine (PubChem CID 121013800) has the molecular formula C12H19NS
and a molecular weight of 209.36 g/mol. Its IUPAC name is 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine |
| PubChem CID | 121013800 |
| Molecular Formula | C12H19NS |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCc1ccc(C2CC2)s1 |
| InChI | InChI=1S/C12H19NS/c1-13(2)9-3-4-11-7-8-12(14-11)10-5-6-10/h7-8,10H,3-6,9H2,1-2H3 |
| InChIKey | WMAQRCVNYHAOGO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine?
The IUPAC name of 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine (CID 121013800) is 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine.
What is the SMILES notation for 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine?
The canonical SMILES for 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine is CN(C)CCCc1ccc(C2CC2)s1.
What is the InChIKey of 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine?
The InChIKey is WMAQRCVNYHAOGO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NS/c1-13(2)9-3-4-11-7-8-12(14-11)10-5-6-10/h7-8,10H,3-6,9H2,1-2H3.
What are the key properties of 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine?
3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine has a molecular weight of 209.36 g/mol, XLogP of 3.12, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-cyclopropylthiophen-2-yl)-N,N-dimethylpropan-1-amine is sourced from PubChem (CID 121013800), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).