C12H10N4O2 — CID 121013966
4,5-dimethoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile (PubChem CID 121013966) has the molecular formula C12H10N4O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 4,5-dimethoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile.
| Compound Name | 4,5-dimethoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
|---|---|
| PubChem CID | 121013966 |
| Molecular Formula | C12H10N4O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.08 |
| IUPAC Name | 4,5-dimethoxycyclohex-4-ene-1,1,2,2-tetracarbonitrile |
| SMILES | COC1=C(OC)CC(C#N)(C#N)C(C#N)(C#N)C1 |
| InChI | InChI=1S/C12H10N4O2/c1-17-9-3-11(5-13,6-14)12(7-15,8-16)4-10(9)18-2/h3-4H2,1-2H3 |
| InChIKey | WYQMVXMJCRGJEE-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 113.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cyano_cyano_A(23)', 'substructure': 'N/A'} |
|---|