C12H27N — CID 121014193
2-tert-butyl-N,N,3,3-tetramethylbutan-1-amine (PubChem CID 121014193) has the molecular formula C12H27N and a molecular weight of 185.35 g/mol. Its IUPAC name is 2-tert-butyl-N,N,3,3-tetramethylbutan-1-amine.
| Compound Name | 2-tert-butyl-N,N,3,3-tetramethylbutan-1-amine |
|---|---|
| PubChem CID | 121014193 |
| Molecular Formula | C12H27N |
| Molecular Weight | 185.35 g/mol |
| Exact Mass | 185.21 |
| IUPAC Name | 2-tert-butyl-N,N,3,3-tetramethylbutan-1-amine |
| SMILES | CN(C)CC(C(C)(C)C)C(C)(C)C |
| InChI | InChI=1S/C12H27N/c1-11(2,3)10(9-13(7)8)12(4,5)6/h10H,9H2,1-8H3 |
| InChIKey | RRMXXUJBNKQVIF-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.35 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |