C12H14N2O — CID 121014240
N,N-dimethyl-5-(4-methylphenyl)-1,3-oxazol-2-amine (PubChem CID 121014240) has the molecular formula C12H14N2O and a molecular weight of 202.26 g/mol. Its IUPAC name is N,N-dimethyl-5-(4-methylphenyl)-1,3-oxazol-2-amine.
| Compound Name | N,N-dimethyl-5-(4-methylphenyl)-1,3-oxazol-2-amine |
|---|---|
| PubChem CID | 121014240 |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.26 g/mol |
| Exact Mass | 202.11 |
| IUPAC Name | N,N-dimethyl-5-(4-methylphenyl)-1,3-oxazol-2-amine |
| SMILES | Cc1ccc(-c2cnc(N(C)C)o2)cc1 |
| InChI | InChI=1S/C12H14N2O/c1-9-4-6-10(7-5-9)11-8-13-12(15-11)14(2)3/h4-8H,1-3H3 |
| InChIKey | NQCXMDUEWRXPHG-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.26 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |