C12H14O3 — CID 121014261
4-tert-butylspiro[7-oxabicyclo[4.1.0]hept-1(6)-ene-5,1'-cyclopropane]-2,3-dione (PubChem CID 121014261) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-tert-butylspiro[7-oxabicyclo[4.1.0]hept-1(6)-ene-5,1'-cyclopropane]-2,3-dione.
| Compound Name | 4-tert-butylspiro[7-oxabicyclo[4.1.0]hept-1(6)-ene-5,1'-cyclopropane]-2,3-dione |
|---|---|
| PubChem CID | 121014261 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-tert-butylspiro[7-oxabicyclo[4.1.0]hept-1(6)-ene-5,1'-cyclopropane]-2,3-dione |
| SMILES | CC(C)(C)C1C(=O)C(=O)C2=C(O2)C12CC2 |
| InChI | InChI=1S/C12H14O3/c1-11(2,3)9-7(14)6(13)8-10(15-8)12(9)4-5-12/h9H,4-5H2,1-3H3 |
| InChIKey | LZCFWIACNMVVEZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 46.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|