C12H14BrNO3 — CID 121015009
1-(4-bromophenyl)-2,3-dimethyl-3-nitrobutan-1-one (PubChem CID 121015009) has the molecular formula C12H14BrNO3 and a molecular weight of 300.15 g/mol. Its IUPAC name is 1-(4-bromophenyl)-2,3-dimethyl-3-nitrobutan-1-one.
| Compound Name | 1-(4-bromophenyl)-2,3-dimethyl-3-nitrobutan-1-one |
|---|---|
| PubChem CID | 121015009 |
| Molecular Formula | C12H14BrNO3 |
| Molecular Weight | 300.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 1-(4-bromophenyl)-2,3-dimethyl-3-nitrobutan-1-one |
| SMILES | CC(C(=O)c1ccc(Br)cc1)C(C)(C)[N+](=O)[O-] |
| InChI | InChI=1S/C12H14BrNO3/c1-8(12(2,3)14(16)17)11(15)9-4-6-10(13)7-5-9/h4-8H,1-3H3 |
| InChIKey | VKUJVXYHRHKRIP-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.15 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|