About 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine
5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine (PubChem CID 121015180) has the molecular formula C12H14O4
and a molecular weight of 222.24 g/mol. Its IUPAC name is 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine.
Molecular Properties
| Compound Name | 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine |
| PubChem CID | 121015180 |
| Molecular Formula | C12H14O4 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine |
| SMILES | C=CCOc1ccc2c(c1OC)OCCO2 |
| InChI | InChI=1S/C12H14O4/c1-3-6-14-9-4-5-10-12(11(9)13-2)16-8-7-15-10/h3-5H,1,6-8H2,2H3 |
| InChIKey | VKCQHEBTLZTDPP-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine?
The IUPAC name of 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine (CID 121015180) is 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine.
What is the SMILES notation for 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine?
The canonical SMILES for 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine is C=CCOc1ccc2c(c1OC)OCCO2.
What is the InChIKey of 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine?
The InChIKey is VKCQHEBTLZTDPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14O4/c1-3-6-14-9-4-5-10-12(11(9)13-2)16-8-7-15-10/h3-5H,1,6-8H2,2H3.
What are the key properties of 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine?
5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine has a molecular weight of 222.24 g/mol, XLogP of 2.03, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-6-prop-2-enoxy-2,3-dihydro-1,4-benzodioxine is sourced from PubChem (CID 121015180), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).