About 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile
3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile (PubChem CID 121015215) has the molecular formula C12H12N4O
and a molecular weight of 228.25 g/mol. Its IUPAC name is 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile.
Molecular Properties
| Compound Name | 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile |
| PubChem CID | 121015215 |
| Molecular Formula | C12H12N4O |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile |
| SMILES | N#CCCN(N)c1ncc(-c2ccccc2)o1 |
| InChI | InChI=1S/C12H12N4O/c13-7-4-8-16(14)12-15-9-11(17-12)10-5-2-1-3-6-10/h1-3,5-6,9H,4,8,14H2 |
| InChIKey | LNHAXEYGYAQSBA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile?
The IUPAC name of 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile (CID 121015215) is 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile.
What is the SMILES notation for 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile?
The canonical SMILES for 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile is N#CCCN(N)c1ncc(-c2ccccc2)o1.
What is the InChIKey of 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile?
The InChIKey is LNHAXEYGYAQSBA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12N4O/c13-7-4-8-16(14)12-15-9-11(17-12)10-5-2-1-3-6-10/h1-3,5-6,9H,4,8,14H2.
What are the key properties of 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile?
3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile has a molecular weight of 228.25 g/mol, XLogP of 1.94, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[amino-(5-phenyl-1,3-oxazol-2-yl)amino]propanenitrile is sourced from PubChem (CID 121015215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).