C12H19F3O — CID 121015261
(6E)-3,7-dimethyl-8-(2,2,2-trifluoroethoxy)octa-1,6-diene (PubChem CID 121015261) has the molecular formula C12H19F3O and a molecular weight of 236.28 g/mol. Its IUPAC name is (6E)-3,7-dimethyl-8-(2,2,2-trifluoroethoxy)octa-1,6-diene.
| Compound Name | (6E)-3,7-dimethyl-8-(2,2,2-trifluoroethoxy)octa-1,6-diene |
|---|---|
| PubChem CID | 121015261 |
| Molecular Formula | C12H19F3O |
| Molecular Weight | 236.28 g/mol |
| Exact Mass | 236.14 |
| IUPAC Name | (6E)-3,7-dimethyl-8-(2,2,2-trifluoroethoxy)octa-1,6-diene |
| SMILES | C=CC(C)CC/C=C(\C)COCC(F)(F)F |
| InChI | InChI=1S/C12H19F3O/c1-4-10(2)6-5-7-11(3)8-16-9-12(13,14)15/h4,7,10H,1,5-6,8-9H2,2-3H3/b11-7+ |
| InChIKey | LNPRIOHZLDHFRO-YRNVUSSQSA-N |
| XLogP | 4.11 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.28 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|