C12H18O2 — CID 121015512
2,5,5-trimethyl-2-prop-2-enylcyclohexane-1,3-dione (PubChem CID 121015512) has the molecular formula C12H18O2 and a molecular weight of 194.27 g/mol. Its IUPAC name is 2,5,5-trimethyl-2-prop-2-enylcyclohexane-1,3-dione.
| Compound Name | 2,5,5-trimethyl-2-prop-2-enylcyclohexane-1,3-dione |
|---|---|
| PubChem CID | 121015512 |
| Molecular Formula | C12H18O2 |
| Molecular Weight | 194.27 g/mol |
| Exact Mass | 194.13 |
| IUPAC Name | 2,5,5-trimethyl-2-prop-2-enylcyclohexane-1,3-dione |
| SMILES | C=CCC1(C)C(=O)CC(C)(C)CC1=O |
| InChI | InChI=1S/C12H18O2/c1-5-6-12(4)9(13)7-11(2,3)8-10(12)14/h5H,1,6-8H2,2-4H3 |
| InChIKey | BPFUUTGEGUVEPI-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|