About (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate
(1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (PubChem CID 121015968) has the molecular formula C12H16O3
and a molecular weight of 208.26 g/mol. Its IUPAC name is (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
Analyze (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The IUPAC name of (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate (CID 121015968) is (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate.
What is the SMILES notation for (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The canonical SMILES for (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate is CC(=O)OC1(C)C(=O)C(C)=CC(C)=C1C.
What is the InChIKey of (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
The InChIKey is HJFPXRNVJBAWGD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O3/c1-7-6-8(2)11(14)12(5,9(7)3)15-10(4)13/h6H,1-5H3.
What are the key properties of (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate?
(1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate has a molecular weight of 208.26 g/mol, XLogP of 2.17, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1,2,3,5-tetramethyl-6-oxocyclohexa-2,4-dien-1-yl) acetate is sourced from PubChem (CID 121015968), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).