C12H12O3 — CID 121016362
3-hydroxy-2,3-dimethyl-2H-naphthalene-1,4-dione (PubChem CID 121016362) has the molecular formula C12H12O3 and a molecular weight of 204.22 g/mol. Its IUPAC name is 3-hydroxy-2,3-dimethyl-2H-naphthalene-1,4-dione.
| Compound Name | 3-hydroxy-2,3-dimethyl-2H-naphthalene-1,4-dione |
|---|---|
| PubChem CID | 121016362 |
| Molecular Formula | C12H12O3 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.08 |
| IUPAC Name | 3-hydroxy-2,3-dimethyl-2H-naphthalene-1,4-dione |
| SMILES | CC1C(=O)c2ccccc2C(=O)C1(C)O |
| InChI | InChI=1S/C12H12O3/c1-7-10(13)8-5-3-4-6-9(8)11(14)12(7,2)15/h3-7,15H,1-2H3 |
| InChIKey | HBHCPYDQQXSFOE-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'keto_keto_gamma(5)', 'substructure': 'N/A'} |
|---|