C23H23N5O3 — CID 121018156
[4-(furan-2-carbonyl)piperazin-1-yl]-[1-(6-phenylpyrimidin-4-yl)azetidin-3-yl]methanone (PubChem CID 121018156) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is [4-(furan-2-carbonyl)piperazin-1-yl]-[1-(6-phenylpyrimidin-4-yl)azetidin-3-yl]methanone.
| Compound Name | [4-(furan-2-carbonyl)piperazin-1-yl]-[1-(6-phenylpyrimidin-4-yl)azetidin-3-yl]methanone |
|---|---|
| PubChem CID | 121018156 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | [4-(furan-2-carbonyl)piperazin-1-yl]-[1-(6-phenylpyrimidin-4-yl)azetidin-3-yl]methanone |
| SMILES | O=C(c1ccco1)N1CCN(C(=O)C2CN(c3cc(-c4ccccc4)ncn3)C2)CC1 |
| InChI | InChI=1S/C23H23N5O3/c29-22(26-8-10-27(11-9-26)23(30)20-7-4-12-31-20)18-14-28(15-18)21-13-19(24-16-25-21)17-5-2-1-3-6-17/h1-7,12-13,16,18H,8-11,14-15H2 |
| InChIKey | GAOAETAMPYFYKB-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |