C18H16N8O — CID 121020007
N-[(1-methyl-3-pyrazin-2-ylpyrazol-5-yl)methyl]-2-phenyltriazole-4-carboxamide (PubChem CID 121020007) has the molecular formula C18H16N8O and a molecular weight of 360.38 g/mol. Its IUPAC name is N-[(1-methyl-3-pyrazin-2-ylpyrazol-5-yl)methyl]-2-phenyltriazole-4-carboxamide.
| Compound Name | N-[(1-methyl-3-pyrazin-2-ylpyrazol-5-yl)methyl]-2-phenyltriazole-4-carboxamide |
|---|---|
| PubChem CID | 121020007 |
| Molecular Formula | C18H16N8O |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.14 |
| IUPAC Name | N-[(1-methyl-3-pyrazin-2-ylpyrazol-5-yl)methyl]-2-phenyltriazole-4-carboxamide |
| SMILES | Cn1nc(-c2cnccn2)cc1CNC(=O)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C18H16N8O/c1-25-14(9-15(23-25)16-11-19-7-8-20-16)10-21-18(27)17-12-22-26(24-17)13-5-3-2-4-6-13/h2-9,11-12H,10H2,1H3,(H,21,27) |
| InChIKey | KGLXMAPWUNMKOL-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 103.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |