C22H21NO3 — CID 121020539
N-[[4-(furan-3-yl)phenyl]methyl]-1-(2-methoxyphenyl)cyclopropane-1-carboxamide (PubChem CID 121020539) has the molecular formula C22H21NO3 and a molecular weight of 347.41 g/mol. Its IUPAC name is N-[[4-(furan-3-yl)phenyl]methyl]-1-(2-methoxyphenyl)cyclopropane-1-carboxamide.
| Compound Name | N-[[4-(furan-3-yl)phenyl]methyl]-1-(2-methoxyphenyl)cyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 121020539 |
| Molecular Formula | C22H21NO3 |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N-[[4-(furan-3-yl)phenyl]methyl]-1-(2-methoxyphenyl)cyclopropane-1-carboxamide |
| SMILES | COc1ccccc1C1(C(=O)NCc2ccc(-c3ccoc3)cc2)CC1 |
| InChI | InChI=1S/C22H21NO3/c1-25-20-5-3-2-4-19(20)22(11-12-22)21(24)23-14-16-6-8-17(9-7-16)18-10-13-26-15-18/h2-10,13,15H,11-12,14H2,1H3,(H,23,24) |
| InChIKey | SGWWQLWZUHZVFK-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |