About 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride
3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride (PubChem CID 121020642) has the molecular formula C12H18ClF3N2O
and a molecular weight of 298.74 g/mol. Its IUPAC name is 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride.
Molecular Properties
| Compound Name | 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride |
| PubChem CID | 121020642 |
| Molecular Formula | C12H18ClF3N2O |
| Molecular Weight | 298.74 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride |
| SMILES | Cc1noc(C)c1CN1CCC(C(F)(F)F)CC1.Cl |
| InChI | InChI=1S/C12H17F3N2O.ClH/c1-8-11(9(2)18-16-8)7-17-5-3-10(4-6-17)12(13,14)15;/h10H,3-7H2,1-2H3;1H |
| InChIKey | SNPRDHTUYMBRMW-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 29.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.74 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride?
The IUPAC name of 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride (CID 121020642) is 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride.
What is the SMILES notation for 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride?
The canonical SMILES for 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride is Cc1noc(C)c1CN1CCC(C(F)(F)F)CC1.Cl.
What is the InChIKey of 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride?
The InChIKey is SNPRDHTUYMBRMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17F3N2O.ClH/c1-8-11(9(2)18-16-8)7-17-5-3-10(4-6-17)12(13,14)15;/h10H,3-7H2,1-2H3;1H.
What are the key properties of 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride?
3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride has a molecular weight of 298.74 g/mol, XLogP of 3.49, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-dimethyl-4-[[4-(trifluoromethyl)piperidin-1-yl]methyl]-1,2-oxazole;hydrochloride is sourced from PubChem (CID 121020642), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).