C10H14FN3O — CID 121020737
4-(5-fluoropyrimidin-2-yl)-2,6-dimethylmorpholine (PubChem CID 121020737) has the molecular formula C10H14FN3O and a molecular weight of 211.24 g/mol. Its IUPAC name is 4-(5-fluoropyrimidin-2-yl)-2,6-dimethylmorpholine.
| Compound Name | 4-(5-fluoropyrimidin-2-yl)-2,6-dimethylmorpholine |
|---|---|
| PubChem CID | 121020737 |
| Molecular Formula | C10H14FN3O |
| Molecular Weight | 211.24 g/mol |
| Exact Mass | 211.11 |
| IUPAC Name | 4-(5-fluoropyrimidin-2-yl)-2,6-dimethylmorpholine |
| SMILES | CC1CN(c2ncc(F)cn2)CC(C)O1 |
| InChI | InChI=1S/C10H14FN3O/c1-7-5-14(6-8(2)15-7)10-12-3-9(11)4-13-10/h3-4,7-8H,5-6H2,1-2H3 |
| InChIKey | LJOAJJLCCZJFRA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 38.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.24 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |