C16H21F2NO — CID 121021894
N-(4,4-difluorocyclohexyl)-3-(3-methylphenyl)propanamide (PubChem CID 121021894) has the molecular formula C16H21F2NO and a molecular weight of 281.35 g/mol. Its IUPAC name is N-(4,4-difluorocyclohexyl)-3-(3-methylphenyl)propanamide.
| Compound Name | N-(4,4-difluorocyclohexyl)-3-(3-methylphenyl)propanamide |
|---|---|
| PubChem CID | 121021894 |
| Molecular Formula | C16H21F2NO |
| Molecular Weight | 281.35 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | N-(4,4-difluorocyclohexyl)-3-(3-methylphenyl)propanamide |
| SMILES | Cc1cccc(CCC(=O)NC2CCC(F)(F)CC2)c1 |
| InChI | InChI=1S/C16H21F2NO/c1-12-3-2-4-13(11-12)5-6-15(20)19-14-7-9-16(17,18)10-8-14/h2-4,11,14H,5-10H2,1H3,(H,19,20) |
| InChIKey | AXBAONRAQABCHG-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |