C18H21F3N4O2 — CID 121022001
2-(4-ethoxyphenyl)-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide (PubChem CID 121022001) has the molecular formula C18H21F3N4O2 and a molecular weight of 382.39 g/mol. Its IUPAC name is 2-(4-ethoxyphenyl)-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide.
| Compound Name | 2-(4-ethoxyphenyl)-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide |
|---|---|
| PubChem CID | 121022001 |
| Molecular Formula | C18H21F3N4O2 |
| Molecular Weight | 382.39 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 2-(4-ethoxyphenyl)-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]acetamide |
| SMILES | CCOc1ccc(CC(=O)NCc2nnc3n2CC(C(F)(F)F)CC3)cc1 |
| InChI | InChI=1S/C18H21F3N4O2/c1-2-27-14-6-3-12(4-7-14)9-17(26)22-10-16-24-23-15-8-5-13(11-25(15)16)18(19,20)21/h3-4,6-7,13H,2,5,8-11H2,1H3,(H,22,26) |
| InChIKey | LVFCTFYYXHOAGA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 69.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.39 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |