C15H16F4N4O2S — CID 121022022
4-fluoro-2-methyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzenesulfonamide (PubChem CID 121022022) has the molecular formula C15H16F4N4O2S and a molecular weight of 392.38 g/mol. Its IUPAC name is 4-fluoro-2-methyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzenesulfonamide.
| Compound Name | 4-fluoro-2-methyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzenesulfonamide |
|---|---|
| PubChem CID | 121022022 |
| Molecular Formula | C15H16F4N4O2S |
| Molecular Weight | 392.38 g/mol |
| Exact Mass | 392.09 |
| IUPAC Name | 4-fluoro-2-methyl-N-[[6-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]benzenesulfonamide |
| SMILES | Cc1cc(F)ccc1S(=O)(=O)NCc1nnc2n1CC(C(F)(F)F)CC2 |
| InChI | InChI=1S/C15H16F4N4O2S/c1-9-6-11(16)3-4-12(9)26(24,25)20-7-14-22-21-13-5-2-10(8-23(13)14)15(17,18)19/h3-4,6,10,20H,2,5,7-8H2,1H3 |
| InChIKey | LANTXECJNNHRJT-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 76.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.38 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |