C18H16F3N5O2 — CID 121022039
2-oxo-N-[[7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1H-quinoline-4-carboxamide (PubChem CID 121022039) has the molecular formula C18H16F3N5O2 and a molecular weight of 391.35 g/mol. Its IUPAC name is 2-oxo-N-[[7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1H-quinoline-4-carboxamide.
| Compound Name | 2-oxo-N-[[7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1H-quinoline-4-carboxamide |
|---|---|
| PubChem CID | 121022039 |
| Molecular Formula | C18H16F3N5O2 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.13 |
| IUPAC Name | 2-oxo-N-[[7-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-3-yl]methyl]-1H-quinoline-4-carboxamide |
| SMILES | O=C(NCc1nnc2n1CCC(C(F)(F)F)C2)c1cc(=O)[nH]c2ccccc12 |
| InChI | InChI=1S/C18H16F3N5O2/c19-18(20,21)10-5-6-26-14(7-10)24-25-15(26)9-22-17(28)12-8-16(27)23-13-4-2-1-3-11(12)13/h1-4,8,10H,5-7,9H2,(H,22,28)(H,23,27) |
| InChIKey | IDFQZGOMIHVMRK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 92.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |