C19H17N5O2 — CID 1210230
6,7-dimethoxy-4-methyl-3-(1-phenyltetrazol-5-yl)quinoline (PubChem CID 1210230) has the molecular formula C19H17N5O2 and a molecular weight of 347.38 g/mol. Its IUPAC name is 6,7-dimethoxy-4-methyl-3-(1-phenyltetrazol-5-yl)quinoline.
| Compound Name | 6,7-dimethoxy-4-methyl-3-(1-phenyltetrazol-5-yl)quinoline |
|---|---|
| PubChem CID | 1210230 |
| Molecular Formula | C19H17N5O2 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 6,7-dimethoxy-4-methyl-3-(1-phenyltetrazol-5-yl)quinoline |
| SMILES | COc1cc2ncc(-c3nnnn3-c3ccccc3)c(C)c2cc1OC |
| InChI | InChI=1S/C19H17N5O2/c1-12-14-9-17(25-2)18(26-3)10-16(14)20-11-15(12)19-21-22-23-24(19)13-7-5-4-6-8-13/h4-11H,1-3H3 |
| InChIKey | WJXITYUYXSROOG-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 74.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |