C5H7ClN2S — CID 121023533
3-chloro-5-propan-2-yl-1,2,4-thiadiazole (PubChem CID 121023533) has the molecular formula C5H7ClN2S and a molecular weight of 162.65 g/mol. Its IUPAC name is 3-chloro-5-propan-2-yl-1,2,4-thiadiazole.
| Compound Name | 3-chloro-5-propan-2-yl-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 121023533 |
| Molecular Formula | C5H7ClN2S |
| Molecular Weight | 162.65 g/mol |
| Exact Mass | 162.00 |
| IUPAC Name | 3-chloro-5-propan-2-yl-1,2,4-thiadiazole |
| SMILES | CC(C)c1nc(Cl)ns1 |
| InChI | InChI=1S/C5H7ClN2S/c1-3(2)4-7-5(6)8-9-4/h3H,1-2H3 |
| InChIKey | YSMOXZMJCPKPCR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.65 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |