C19H16N4O3S — CID 121024665
2-(2,5-dioxopyrrolidin-1-yl)-N-[2-methyl-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]acetamide (PubChem CID 121024665) has the molecular formula C19H16N4O3S and a molecular weight of 380.43 g/mol. Its IUPAC name is 2-(2,5-dioxopyrrolidin-1-yl)-N-[2-methyl-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]acetamide.
| Compound Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[2-methyl-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 121024665 |
| Molecular Formula | C19H16N4O3S |
| Molecular Weight | 380.43 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | 2-(2,5-dioxopyrrolidin-1-yl)-N-[2-methyl-4-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]acetamide |
| SMILES | Cc1cc(-c2nc3cccnc3s2)ccc1NC(=O)CN1C(=O)CCC1=O |
| InChI | InChI=1S/C19H16N4O3S/c1-11-9-12(18-22-14-3-2-8-20-19(14)27-18)4-5-13(11)21-15(24)10-23-16(25)6-7-17(23)26/h2-5,8-9H,6-7,10H2,1H3,(H,21,24) |
| InChIKey | IMDVKGJTEWBHOB-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.43 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|