C23H19N3O2S — CID 121024683
(E)-3-(4-methoxyphenyl)-N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide (PubChem CID 121024683) has the molecular formula C23H19N3O2S and a molecular weight of 401.49 g/mol. Its IUPAC name is (E)-3-(4-methoxyphenyl)-N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide.
| Compound Name | (E)-3-(4-methoxyphenyl)-N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 121024683 |
| Molecular Formula | C23H19N3O2S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | (E)-3-(4-methoxyphenyl)-N-[2-methyl-5-([1,3]thiazolo[5,4-b]pyridin-2-yl)phenyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)Nc2cc(-c3nc4cccnc4s3)ccc2C)cc1 |
| InChI | InChI=1S/C23H19N3O2S/c1-15-5-9-17(22-26-19-4-3-13-24-23(19)29-22)14-20(15)25-21(27)12-8-16-6-10-18(28-2)11-7-16/h3-14H,1-2H3,(H,25,27)/b12-8+ |
| InChIKey | RIIIFWDERIFWGM-XYOKQWHBSA-N |
| XLogP | 5.33 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|