C15H16N4O5 — CID 121025857
4-[3-(furan-2-ylmethyl)-2,4-dioxo-1H-pyrimidine-5-carbonyl]piperazine-1-carbaldehyde (PubChem CID 121025857) has the molecular formula C15H16N4O5 and a molecular weight of 332.32 g/mol. Its IUPAC name is 4-[3-(furan-2-ylmethyl)-2,4-dioxo-1H-pyrimidine-5-carbonyl]piperazine-1-carbaldehyde.
| Compound Name | 4-[3-(furan-2-ylmethyl)-2,4-dioxo-1H-pyrimidine-5-carbonyl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 121025857 |
| Molecular Formula | C15H16N4O5 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.11 |
| IUPAC Name | 4-[3-(furan-2-ylmethyl)-2,4-dioxo-1H-pyrimidine-5-carbonyl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(C(=O)c2c[nH]c(=O)n(Cc3ccco3)c2=O)CC1 |
| InChI | InChI=1S/C15H16N4O5/c20-10-17-3-5-18(6-4-17)13(21)12-8-16-15(23)19(14(12)22)9-11-2-1-7-24-11/h1-2,7-8,10H,3-6,9H2,(H,16,23) |
| InChIKey | WWVPEKZXCONFSP-UHFFFAOYSA-N |
| XLogP | -0.91 |
| TPSA | 108.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | -0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|