C20H20N4O3 — CID 121026533
2,4-dioxo-N-(3-phenylpropyl)-3-(pyridin-2-ylmethyl)-1H-pyrimidine-5-carboxamide (PubChem CID 121026533) has the molecular formula C20H20N4O3 and a molecular weight of 364.41 g/mol. Its IUPAC name is 2,4-dioxo-N-(3-phenylpropyl)-3-(pyridin-2-ylmethyl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 2,4-dioxo-N-(3-phenylpropyl)-3-(pyridin-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121026533 |
| Molecular Formula | C20H20N4O3 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | 2,4-dioxo-N-(3-phenylpropyl)-3-(pyridin-2-ylmethyl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(NCCCc1ccccc1)c1c[nH]c(=O)n(Cc2ccccn2)c1=O |
| InChI | InChI=1S/C20H20N4O3/c25-18(22-12-6-9-15-7-2-1-3-8-15)17-13-23-20(27)24(19(17)26)14-16-10-4-5-11-21-16/h1-5,7-8,10-11,13H,6,9,12,14H2,(H,22,25)(H,23,27) |
| InChIKey | WCNWWHGQORVEGK-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|