C19H17ClN4O3S — CID 121027174
3-[(2-chlorophenyl)methyl]-2,4-dioxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1H-pyrimidine-5-carboxamide (PubChem CID 121027174) has the molecular formula C19H17ClN4O3S and a molecular weight of 416.89 g/mol. Its IUPAC name is 3-[(2-chlorophenyl)methyl]-2,4-dioxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1H-pyrimidine-5-carboxamide.
| Compound Name | 3-[(2-chlorophenyl)methyl]-2,4-dioxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1H-pyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 121027174 |
| Molecular Formula | C19H17ClN4O3S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | 3-[(2-chlorophenyl)methyl]-2,4-dioxo-N-(4,5,6,7-tetrahydro-1,3-benzothiazol-2-yl)-1H-pyrimidine-5-carboxamide |
| SMILES | O=C(Nc1nc2c(s1)CCCC2)c1c[nH]c(=O)n(Cc2ccccc2Cl)c1=O |
| InChI | InChI=1S/C19H17ClN4O3S/c20-13-6-2-1-5-11(13)10-24-17(26)12(9-21-19(24)27)16(25)23-18-22-14-7-3-4-8-15(14)28-18/h1-2,5-6,9H,3-4,7-8,10H2,(H,21,27)(H,22,23,25) |
| InChIKey | XVYCTEMVDITINN-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 96.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |