C22H22N4O — CID 121027928
N-(2-phenylphenyl)-6-piperidin-1-ylpyridazine-3-carboxamide (PubChem CID 121027928) has the molecular formula C22H22N4O and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(2-phenylphenyl)-6-piperidin-1-ylpyridazine-3-carboxamide.
| Compound Name | N-(2-phenylphenyl)-6-piperidin-1-ylpyridazine-3-carboxamide |
|---|---|
| PubChem CID | 121027928 |
| Molecular Formula | C22H22N4O |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.18 |
| IUPAC Name | N-(2-phenylphenyl)-6-piperidin-1-ylpyridazine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1-c1ccccc1)c1ccc(N2CCCCC2)nn1 |
| InChI | InChI=1S/C22H22N4O/c27-22(20-13-14-21(25-24-20)26-15-7-2-8-16-26)23-19-12-6-5-11-18(19)17-9-3-1-4-10-17/h1,3-6,9-14H,2,7-8,15-16H2,(H,23,27) |
| InChIKey | VQLGYMKHBYJXIK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |