C16H18N4O3S — CID 121028038
methyl 3-[(6-piperidin-1-ylpyridazine-3-carbonyl)amino]thiophene-2-carboxylate (PubChem CID 121028038) has the molecular formula C16H18N4O3S and a molecular weight of 346.41 g/mol. Its IUPAC name is methyl 3-[(6-piperidin-1-ylpyridazine-3-carbonyl)amino]thiophene-2-carboxylate.
| Compound Name | methyl 3-[(6-piperidin-1-ylpyridazine-3-carbonyl)amino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 121028038 |
| Molecular Formula | C16H18N4O3S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.11 |
| IUPAC Name | methyl 3-[(6-piperidin-1-ylpyridazine-3-carbonyl)amino]thiophene-2-carboxylate |
| SMILES | COC(=O)c1sccc1NC(=O)c1ccc(N2CCCCC2)nn1 |
| InChI | InChI=1S/C16H18N4O3S/c1-23-16(22)14-11(7-10-24-14)17-15(21)12-5-6-13(19-18-12)20-8-3-2-4-9-20/h5-7,10H,2-4,8-9H2,1H3,(H,17,21) |
| InChIKey | XPDSGEXONGWUQW-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 84.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |