C23H21N3O3 — CID 121028699
3,4-dimethoxy-N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide (PubChem CID 121028699) has the molecular formula C23H21N3O3 and a molecular weight of 387.44 g/mol. Its IUPAC name is 3,4-dimethoxy-N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide.
| Compound Name | 3,4-dimethoxy-N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
|---|---|
| PubChem CID | 121028699 |
| Molecular Formula | C23H21N3O3 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.16 |
| IUPAC Name | 3,4-dimethoxy-N-[3-(8-methylimidazo[1,2-a]pyridin-2-yl)phenyl]benzamide |
| SMILES | COc1ccc(C(=O)Nc2cccc(-c3cn4cccc(C)c4n3)c2)cc1OC |
| InChI | InChI=1S/C23H21N3O3/c1-15-6-5-11-26-14-19(25-22(15)26)16-7-4-8-18(12-16)24-23(27)17-9-10-20(28-2)21(13-17)29-3/h4-14H,1-3H3,(H,24,27) |
| InChIKey | PEOIXLBVJJQXKC-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 64.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |